C22H22ClFN6 — CID 168978886
4-[4-chloro-6-(4,7-diazaspiro[2.5]octan-7-yl)-1,8-naphthyridin-2-yl]-2-fluoro-6-(methyliminomethyl)aniline (PubChem CID 168978886) has the molecular formula C22H22ClFN6 and a molecular weight of 424.91 g/mol. Its IUPAC name is 4-[4-chloro-6-(4,7-diazaspiro[2.5]octan-7-yl)-1,8-naphthyridin-2-yl]-2-fluoro-6-(methyliminomethyl)aniline.
| Compound Name | 4-[4-chloro-6-(4,7-diazaspiro[2.5]octan-7-yl)-1,8-naphthyridin-2-yl]-2-fluoro-6-(methyliminomethyl)aniline |
|---|---|
| PubChem CID | 168978886 |
| Molecular Formula | C22H22ClFN6 |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-[4-chloro-6-(4,7-diazaspiro[2.5]octan-7-yl)-1,8-naphthyridin-2-yl]-2-fluoro-6-(methyliminomethyl)aniline |
| SMILES | C/N=C/c1cc(-c2cc(Cl)c3cc(N4CCNC5(CC5)C4)cnc3n2)cc(F)c1N |
| InChI | InChI=1S/C22H22ClFN6/c1-26-10-14-6-13(7-18(24)20(14)25)19-9-17(23)16-8-15(11-27-21(16)29-19)30-5-4-28-22(12-30)2-3-22/h6-11,28H,2-5,12,25H2,1H3/b26-10+ |
| InChIKey | OBINTRNHJYNYKB-NSKAYECMSA-N |
| XLogP | 3.66 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|