About 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one
5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one (PubChem CID 168979554) has the molecular formula C19H27BrN2O2
and a molecular weight of 395.34 g/mol. Its IUPAC name is 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one.
Molecular Properties
| Compound Name | 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one |
| PubChem CID | 168979554 |
| Molecular Formula | C19H27BrN2O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one |
| SMILES | CCC(=O)CC(C)(C)O.Cc1nn2ccc(Br)cc2c1C1CCC1 |
| InChI | InChI=1S/C12H13BrN2.C7H14O2/c1-8-12(9-3-2-4-9)11-7-10(13)5-6-15(11)14-8;1-4-6(8)5-7(2,3)9/h5-7,9H,2-4H2,1H3;9H,4-5H2,1-3H3 |
| InChIKey | KLMIBLISDTVVHZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one?
The IUPAC name of 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one (CID 168979554) is 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one.
What is the SMILES notation for 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one?
The canonical SMILES for 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one is CCC(=O)CC(C)(C)O.Cc1nn2ccc(Br)cc2c1C1CCC1.
What is the InChIKey of 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one?
The InChIKey is KLMIBLISDTVVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2.C7H14O2/c1-8-12(9-3-2-4-9)11-7-10(13)5-6-15(11)14-8;1-4-6(8)5-7(2,3)9/h5-7,9H,2-4H2,1H3;9H,4-5H2,1-3H3.
What are the key properties of 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one?
5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one has a molecular weight of 395.34 g/mol, XLogP of 4.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-cyclobutyl-2-methylpyrazolo[1,5-a]pyridine;5-hydroxy-5-methylhexan-3-one is sourced from PubChem (CID 168979554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).