C21H34N2 — CID 168980312
1-propan-2-yl-4-[5-(4-propan-2-ylpiperidin-1-yl)penta-1,3-diynyl]piperidine (PubChem CID 168980312) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-propan-2-yl-4-[5-(4-propan-2-ylpiperidin-1-yl)penta-1,3-diynyl]piperidine.
| Compound Name | 1-propan-2-yl-4-[5-(4-propan-2-ylpiperidin-1-yl)penta-1,3-diynyl]piperidine |
|---|---|
| PubChem CID | 168980312 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-propan-2-yl-4-[5-(4-propan-2-ylpiperidin-1-yl)penta-1,3-diynyl]piperidine |
| SMILES | CC(C)C1CCN(CC#CC#CC2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H34N2/c1-18(2)21-11-14-22(15-12-21)13-7-5-6-8-20-9-16-23(17-10-20)19(3)4/h18-21H,9-17H2,1-4H3 |
| InChIKey | WYIVULGTSJHASI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|