C21H20FN5O3 — CID 16898109
N-(3,5-dimethylphenyl)-2-[8-(4-fluorophenyl)-3,4-dioxo-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide (PubChem CID 16898109) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[8-(4-fluorophenyl)-3,4-dioxo-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[8-(4-fluorophenyl)-3,4-dioxo-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 16898109 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[8-(4-fluorophenyl)-3,4-dioxo-6,7-dihydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)Cn2nc3n(c(=O)c2=O)CCN3c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H20FN5O3/c1-13-9-14(2)11-16(10-13)23-18(28)12-27-20(30)19(29)26-8-7-25(21(26)24-27)17-5-3-15(22)4-6-17/h3-6,9-11H,7-8,12H2,1-2H3,(H,23,28) |
| InChIKey | KXJOKKJLDANDOV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|