C27H29FN5O7PS — CID 168981345
[[2-[[(3S,6S,9aS)-5-oxo-3-[3-(4-oxopyrimidin-1-yl)azetidine-1-carbonyl]-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid (PubChem CID 168981345) has the molecular formula C27H29FN5O7PS and a molecular weight of 617.60 g/mol. Its IUPAC name is [[2-[[(3S,6S,9aS)-5-oxo-3-[3-(4-oxopyrimidin-1-yl)azetidine-1-carbonyl]-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid.
| Compound Name | [[2-[[(3S,6S,9aS)-5-oxo-3-[3-(4-oxopyrimidin-1-yl)azetidine-1-carbonyl]-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 168981345 |
| Molecular Formula | C27H29FN5O7PS |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | [[2-[[(3S,6S,9aS)-5-oxo-3-[3-(4-oxopyrimidin-1-yl)azetidine-1-carbonyl]-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-fluoromethyl]phosphonic acid |
| SMILES | O=C(N[C@H]1CCC[C@H]2CC[C@@H](C(=O)N3CC(n4ccc(=O)nc4)C3)N2C1=O)c1cc2cc(C(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C27H29FN5O7PS/c28-24(41(38,39)40)15-4-7-21-16(10-15)11-22(42-21)25(35)30-19-3-1-2-17-5-6-20(33(17)26(19)36)27(37)32-12-18(13-32)31-9-8-23(34)29-14-31/h4,7-11,14,17-20,24H,1-3,5-6,12-13H2,(H,30,35)(H2,38,39,40)/t17-,19-,20-,24?/m0/s1 |
| InChIKey | RIJWQIGHPYTBCF-ORVMIJCVSA-N |
| XLogP | 2.33 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|