C17H9F5NO5P — CID 168981425
[7-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-2-yl]methylphosphonic acid (PubChem CID 168981425) has the molecular formula C17H9F5NO5P and a molecular weight of 433.23 g/mol. Its IUPAC name is [7-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-2-yl]methylphosphonic acid.
| Compound Name | [7-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 168981425 |
| Molecular Formula | C17H9F5NO5P |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | [7-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-2-yl]methylphosphonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2ccc(CP(=O)(O)O)nc2c1 |
| InChI | InChI=1S/C17H9F5NO5P/c18-11-12(19)14(21)16(15(22)13(11)20)28-17(24)8-2-1-7-3-4-9(6-29(25,26)27)23-10(7)5-8/h1-5H,6H2,(H2,25,26,27) |
| InChIKey | IJRVZALOJGFYJQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|