C17H31F2O7P — CID 168981433
[(1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 168981433) has the molecular formula C17H31F2O7P and a molecular weight of 416.40 g/mol. Its IUPAC name is [(1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 168981433 |
| Molecular Formula | C17H31F2O7P |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(1,1-difluoro-2-methylbutyl)-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CCC(C)C(F)(F)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H31F2O7P/c1-9-12(2)17(18,19)27(22,25-10-23-13(20)15(3,4)5)26-11-24-14(21)16(6,7)8/h12H,9-11H2,1-8H3 |
| InChIKey | XGINFOGUKFYQNC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|