C13H15N3O4 — CID 168981527
1-(diformylamino)-N-(6-methoxy-3-pyridinyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 168981527) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(diformylamino)-N-(6-methoxy-3-pyridinyl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | 1-(diformylamino)-N-(6-methoxy-3-pyridinyl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 168981527 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(diformylamino)-N-(6-methoxy-3-pyridinyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)C2(N(C=O)C=O)CC2)cn1 |
| InChI | InChI=1S/C13H15N3O4/c1-15(10-3-4-11(20-2)14-7-10)12(19)13(5-6-13)16(8-17)9-18/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | PDNFYHHQXTVBLO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|