C13H17N3O2S — CID 168983026
1-[(2S)-1-(5-aminosulfanylpyridine-2-carbonyl)pyrrolidin-2-yl]propan-1-one (PubChem CID 168983026) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-[(2S)-1-(5-aminosulfanylpyridine-2-carbonyl)pyrrolidin-2-yl]propan-1-one.
| Compound Name | 1-[(2S)-1-(5-aminosulfanylpyridine-2-carbonyl)pyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 168983026 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-[(2S)-1-(5-aminosulfanylpyridine-2-carbonyl)pyrrolidin-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@@H]1CCCN1C(=O)c1ccc(SN)cn1 |
| InChI | InChI=1S/C13H17N3O2S/c1-2-12(17)11-4-3-7-16(11)13(18)10-6-5-9(19-14)8-15-10/h5-6,8,11H,2-4,7,14H2,1H3/t11-/m0/s1 |
| InChIKey | CKDTVKYGOWNRTL-NSHDSACASA-N |
| XLogP | 1.63 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|