C28H35N3O5S — CID 168983051
6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl (2R)-1-(6-sulfamoylpyridine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 168983051) has the molecular formula C28H35N3O5S and a molecular weight of 525.67 g/mol. Its IUPAC name is 6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl (2R)-1-(6-sulfamoylpyridine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | 6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl (2R)-1-(6-sulfamoylpyridine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 168983051 |
| Molecular Formula | C28H35N3O5S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl (2R)-1-(6-sulfamoylpyridine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2CCC[C@@H]2C(=O)OC2CCC3C2CCC2C4C=CCC=C4CCC23)cn1 |
| InChI | InChI=1S/C28H35N3O5S/c29-37(34,35)26-14-8-18(16-30-26)27(32)31-15-3-6-24(31)28(33)36-25-13-12-22-21-9-7-17-4-1-2-5-19(17)20(21)10-11-23(22)25/h2,4-5,8,14,16,19-25H,1,3,6-7,9-13,15H2,(H2,29,34,35)/t19?,20?,21?,22?,23?,24-,25?/m1/s1 |
| InChIKey | OWHYLBORXHTIGB-KUZBWMJKSA-N |
| XLogP | 3.59 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|