About 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane
6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 168983155) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane |
| PubChem CID | 168983155 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | C=CC(=C)N1C2CC1CN(C)C2 |
| InChI | InChI=1S/C10H16N2/c1-4-8(2)12-9-5-10(12)7-11(3)6-9/h4,9-10H,1-2,5-7H2,3H3 |
| InChIKey | LYTLQSSZMDOQOX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane?
The IUPAC name of 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane (CID 168983155) is 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane.
What is the SMILES notation for 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane?
The canonical SMILES for 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane is C=CC(=C)N1C2CC1CN(C)C2.
What is the InChIKey of 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane?
The InChIKey is LYTLQSSZMDOQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-4-8(2)12-9-5-10(12)7-11(3)6-9/h4,9-10H,1-2,5-7H2,3H3.
What are the key properties of 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane?
6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane has a molecular weight of 164.25 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-buta-1,3-dien-2-yl-3-methyl-3,6-diazabicyclo[3.1.1]heptane is sourced from PubChem (CID 168983155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).