C18H34N4O — CID 168983173
1-(cyclopropylmethyl)-N,N,4,10,10-pentamethyl-1,4,9-triazaspiro[5.5]undecane-9-carboxamide (PubChem CID 168983173) has the molecular formula C18H34N4O and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N,N,4,10,10-pentamethyl-1,4,9-triazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-N,N,4,10,10-pentamethyl-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 168983173 |
| Molecular Formula | C18H34N4O |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-(cyclopropylmethyl)-N,N,4,10,10-pentamethyl-1,4,9-triazaspiro[5.5]undecane-9-carboxamide |
| SMILES | CN1CCN(CC2CC2)C2(CCN(C(=O)N(C)C)C(C)(C)C2)C1 |
| InChI | InChI=1S/C18H34N4O/c1-17(2)13-18(8-9-22(17)16(23)19(3)4)14-20(5)10-11-21(18)12-15-6-7-15/h15H,6-14H2,1-5H3 |
| InChIKey | FPJFKZXUTBYTDF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |