C12H16F3N — CID 168983385
(3Z,5Z)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)octa-1,3,5,7-tetraen-4-amine (PubChem CID 168983385) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is (3Z,5Z)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3Z,5Z)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 168983385 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (3Z,5Z)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C(/C)C=C)N(C)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3N/c1-5-7-8-11(10(3)6-2)16(4)9-12(13,14)15/h5-8H,1-2,9H2,3-4H3/b8-7-,11-10- |
| InChIKey | FJECYKBQBMKNGT-NQLNTKRDSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|