C8H13NO2 — CID 168983562
4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carbaldehyde (PubChem CID 168983562) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carbaldehyde.
| Compound Name | 4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carbaldehyde |
|---|---|
| PubChem CID | 168983562 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carbaldehyde |
| SMILES | CN1CC(C=O)C2OCCC21 |
| InChI | InChI=1S/C8H13NO2/c1-9-4-6(5-10)8-7(9)2-3-11-8/h5-8H,2-4H2,1H3 |
| InChIKey | QQRHLSLUPNCELS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|