About (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine
(6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine (PubChem CID 168983879) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine.
Molecular Properties
| Compound Name | (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine |
| PubChem CID | 168983879 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine |
| SMILES | CC/N=C1\C2=C(C=C\C1=C(\C)CC)N(CC)CCC2 |
| InChI | InChI=1S/C17H26N2/c1-5-13(4)14-10-11-16-15(17(14)18-6-2)9-8-12-19(16)7-3/h10-11H,5-9,12H2,1-4H3/b14-13+,18-17- |
| InChIKey | QFPRWAJLOJBWHC-ZOHXKJJCSA-N |
| XLogP | 4.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine?
The IUPAC name of (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine (CID 168983879) is (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine.
What is the SMILES notation for (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine?
The canonical SMILES for (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine is CC/N=C1\C2=C(C=C\C1=C(\C)CC)N(CC)CCC2.
What is the InChIKey of (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine?
The InChIKey is QFPRWAJLOJBWHC-ZOHXKJJCSA-N. The full InChI is InChI=1S/C17H26N2/c1-5-13(4)14-10-11-16-15(17(14)18-6-2)9-8-12-19(16)7-3/h10-11H,5-9,12H2,1-4H3/b14-13+,18-17-.
What are the key properties of (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine?
(6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine has a molecular weight of 258.41 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-butan-2-ylidene-N,1-diethyl-3,4-dihydro-2H-quinolin-5-imine is sourced from PubChem (CID 168983879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).