C27H29F6N7O2Si — CID 168984005
(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methylidene]-3-[2-[tert-butyl(dimethyl)silyl]ethyl]-1-(pyrimidin-5-ylmethyl)imidazolidine-2,4-dione (PubChem CID 168984005) has the molecular formula C27H29F6N7O2Si and a molecular weight of 625.65 g/mol. Its IUPAC name is (5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methylidene]-3-[2-[tert-butyl(dimethyl)silyl]ethyl]-1-(pyrimidin-5-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methylidene]-3-[2-[tert-butyl(dimethyl)silyl]ethyl]-1-(pyrimidin-5-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 168984005 |
| Molecular Formula | C27H29F6N7O2Si |
| Molecular Weight | 625.65 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | (5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]methylidene]-3-[2-[tert-butyl(dimethyl)silyl]ethyl]-1-(pyrimidin-5-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)CCN1C(=O)/C(=C/n2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)N(Cc2cncnc2)C1=O |
| InChI | InChI=1S/C27H29F6N7O2Si/c1-25(2,3)43(4,5)7-6-39-23(41)21(40(24(39)42)13-17-11-34-15-35-12-17)14-38-16-36-22(37-38)18-8-19(26(28,29)30)10-20(9-18)27(31,32)33/h8-12,14-16H,6-7,13H2,1-5H3/b21-14- |
| InChIKey | FSRSDNAMNFEDFK-STZFKDTASA-N |
| XLogP | 6.54 |
| TPSA | 97.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|