C19H17F3N6O2 — CID 168984023
(E)-3-[3-[2-tert-butyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoic acid (PubChem CID 168984023) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is (E)-3-[3-[2-tert-butyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-tert-butyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 168984023 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-3-[3-[2-tert-butyl-6-(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoic acid |
| SMILES | CC(C)(C)c1cc(-c2ncn(/C=C(/C(=O)O)c3cncnc3)n2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H17F3N6O2/c1-18(2,3)14-4-11(5-15(26-14)19(20,21)22)16-25-10-28(27-16)8-13(17(29)30)12-6-23-9-24-7-12/h4-10H,1-3H3,(H,29,30)/b13-8+ |
| InChIKey | HNPUOITXUOMCFY-MDWZMJQESA-N |
| XLogP | 3.53 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|