C17H10F6N6O2 — CID 168984090
methyl (E)-3-[3-[4,6-bis(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoate (PubChem CID 168984090) has the molecular formula C17H10F6N6O2 and a molecular weight of 444.30 g/mol. Its IUPAC name is methyl (E)-3-[3-[4,6-bis(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoate.
| Compound Name | methyl (E)-3-[3-[4,6-bis(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoate |
|---|---|
| PubChem CID | 168984090 |
| Molecular Formula | C17H10F6N6O2 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | methyl (E)-3-[3-[4,6-bis(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enoate |
| SMILES | COC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)n2)n1)c1cncnc1 |
| InChI | InChI=1S/C17H10F6N6O2/c1-31-15(30)11(9-4-24-7-25-5-9)6-29-8-26-14(28-29)12-2-10(16(18,19)20)3-13(27-12)17(21,22)23/h2-8H,1H3/b11-6+ |
| InChIKey | HSOSDGJAJPKTHG-IZZDOVSWSA-N |
| XLogP | 3.34 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|