About methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate
methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate (PubChem CID 168984522) has the molecular formula C13H19ClN2O3
and a molecular weight of 286.76 g/mol. Its IUPAC name is methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate |
| PubChem CID | 168984522 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)n1nc(Cl)c(C)c(C)c1=O |
| InChI | InChI=1S/C13H19ClN2O3/c1-7(2)6-10(13(18)19-5)16-12(17)9(4)8(3)11(14)15-16/h7,10H,6H2,1-5H3/t10-/m0/s1 |
| InChIKey | PCLIPOPVYLIBJC-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate (CID 168984522) is methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate is COC(=O)[C@H](CC(C)C)n1nc(Cl)c(C)c(C)c1=O.
What is the InChIKey of methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate?
The InChIKey is PCLIPOPVYLIBJC-JTQLQIEISA-N. The full InChI is InChI=1S/C13H19ClN2O3/c1-7(2)6-10(13(18)19-5)16-12(17)9(4)8(3)11(14)15-16/h7,10H,6H2,1-5H3/t10-/m0/s1.
What are the key properties of methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate?
methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate has a molecular weight of 286.76 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(3-chloro-4,5-dimethyl-6-oxopyridazin-1-yl)-4-methylpentanoate is sourced from PubChem (CID 168984522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).