C14H12ClNO3 — CID 168984872
4-[5-chloro-2-(trideuteriomethoxy)phenyl]-6-methylpyridine-3-carboxylic acid (PubChem CID 168984872) has the molecular formula C14H12ClNO3 and a molecular weight of 280.73 g/mol. Its IUPAC name is 4-[5-chloro-2-(trideuteriomethoxy)phenyl]-6-methylpyridine-3-carboxylic acid.
| Compound Name | 4-[5-chloro-2-(trideuteriomethoxy)phenyl]-6-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168984872 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-[5-chloro-2-(trideuteriomethoxy)phenyl]-6-methylpyridine-3-carboxylic acid |
| SMILES | [2H]C([2H])([2H])Oc1ccc(Cl)cc1-c1cc(C)ncc1C(=O)O |
| InChI | InChI=1S/C14H12ClNO3/c1-8-5-10(12(7-16-8)14(17)18)11-6-9(15)3-4-13(11)19-2/h3-7H,1-2H3,(H,17,18)/i2D3 |
| InChIKey | YTORVSMPIABLLJ-BMSJAHLVSA-N |
| XLogP | 3.42 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |