About ethane;nonyl 8-(methylamino)octanoate;propane
ethane;nonyl 8-(methylamino)octanoate;propane (PubChem CID 168985464) has the molecular formula C31H73NO2
and a molecular weight of 491.93 g/mol. Its IUPAC name is ethane;nonyl 8-(methylamino)octanoate;propane.
Molecular Properties
| Compound Name | ethane;nonyl 8-(methylamino)octanoate;propane |
| PubChem CID | 168985464 |
| Molecular Formula | C31H73NO2 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.56 |
| IUPAC Name | ethane;nonyl 8-(methylamino)octanoate;propane |
| SMILES | CC.CC.CCC.CCC.CCC.CCCCCCCCCOC(=O)CCCCCCCNC |
| InChI | InChI=1S/C18H37NO2.3C3H8.2C2H6/c1-3-4-5-6-7-11-14-17-21-18(20)15-12-9-8-10-13-16-19-2;3*1-3-2;2*1-2/h19H,3-17H2,1-2H3;3*3H2,1-2H3;2*1-2H3 |
| InChIKey | SVVZROCAENKKFB-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;nonyl 8-(methylamino)octanoate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;nonyl 8-(methylamino)octanoate;propane?
The IUPAC name of ethane;nonyl 8-(methylamino)octanoate;propane (CID 168985464) is ethane;nonyl 8-(methylamino)octanoate;propane.
What is the SMILES notation for ethane;nonyl 8-(methylamino)octanoate;propane?
The canonical SMILES for ethane;nonyl 8-(methylamino)octanoate;propane is CC.CC.CCC.CCC.CCC.CCCCCCCCCOC(=O)CCCCCCCNC.
What is the InChIKey of ethane;nonyl 8-(methylamino)octanoate;propane?
The InChIKey is SVVZROCAENKKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2.3C3H8.2C2H6/c1-3-4-5-6-7-11-14-17-21-18(20)15-12-9-8-10-13-16-19-2;3*1-3-2;2*1-2/h19H,3-17H2,1-2H3;3*3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;nonyl 8-(methylamino)octanoate;propane?
ethane;nonyl 8-(methylamino)octanoate;propane has a molecular weight of 491.93 g/mol, XLogP of 11.14, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;nonyl 8-(methylamino)octanoate;propane is sourced from PubChem (CID 168985464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).