C15H23F3N2O5 — CID 168985850
ethyl (2S,3S)-3-[[(2S)-4,4,4-trifluoro-1-(3-methylbutylamino)-1-oxobutan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 168985850) has the molecular formula C15H23F3N2O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[(2S)-4,4,4-trifluoro-1-(3-methylbutylamino)-1-oxobutan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[(2S)-4,4,4-trifluoro-1-(3-methylbutylamino)-1-oxobutan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 168985850 |
| Molecular Formula | C15H23F3N2O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | ethyl (2S,3S)-3-[[(2S)-4,4,4-trifluoro-1-(3-methylbutylamino)-1-oxobutan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CC(F)(F)F)C(=O)NCCC(C)C |
| InChI | InChI=1S/C15H23F3N2O5/c1-4-24-14(23)11-10(25-11)13(22)20-9(7-15(16,17)18)12(21)19-6-5-8(2)3/h8-11H,4-7H2,1-3H3,(H,19,21)(H,20,22)/t9-,10-,11-/m0/s1 |
| InChIKey | IIVICTWKNDYTKU-DCAQKATOSA-N |
| XLogP | 0.92 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|