About zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate
zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate (PubChem CID 168986218) has the molecular formula C10H11N5O2S2Zn
and a molecular weight of 362.76 g/mol. Its IUPAC name is zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate.
Molecular Properties
| Compound Name | zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate |
| PubChem CID | 168986218 |
| Molecular Formula | C10H11N5O2S2Zn |
| Molecular Weight | 362.76 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(=S)c([S-])nc2c1.[NH-]CCN.[Zn+2] |
| InChI | InChI=1S/C8H5N3O2S2.C2H7N2.Zn/c12-11(13)4-1-2-5-6(3-4)10-8(15)7(14)9-5;3-1-2-4;/h1-3H,(H,9,14)(H,10,15);3H,1-2,4H2;/q;-1;+2/p-1 |
| InChIKey | MOCWERQHLPSGOT-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate?
The IUPAC name of zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate (CID 168986218) is zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate.
What is the SMILES notation for zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate?
The canonical SMILES for zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate is O=[N+]([O-])c1ccc2[nH]c(=S)c([S-])nc2c1.[NH-]CCN.[Zn+2].
What is the InChIKey of zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate?
The InChIKey is MOCWERQHLPSGOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H5N3O2S2.C2H7N2.Zn/c12-11(13)4-1-2-5-6(3-4)10-8(15)7(14)9-5;3-1-2-4;/h1-3H,(H,9,14)(H,10,15);3H,1-2,4H2;/q;-1;+2/p-1.
What are the key properties of zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate?
zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate has a molecular weight of 362.76 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-aminoethylazanide;7-nitro-3-sulfanylidene-4H-quinoxaline-2-thiolate is sourced from PubChem (CID 168986218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).