C9H19NO — CID 168986693
1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethanol (PubChem CID 168986693) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethanol.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethanol |
|---|---|
| PubChem CID | 168986693 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;ethanol |
| SMILES | C1CC2CNCC2C1.CCO |
| InChI | InChI=1S/C7H13N.C2H6O/c1-2-6-4-8-5-7(6)3-1;1-2-3/h6-8H,1-5H2;3H,2H2,1H3 |
| InChIKey | ZVYZUHJBIQBYQI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |