C23H25F3N4O2S — CID 168986869
N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 168986869) has the molecular formula C23H25F3N4O2S and a molecular weight of 478.54 g/mol. Its IUPAC name is N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 168986869 |
| Molecular Formula | C23H25F3N4O2S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[5-[2-[(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethoxy]-1H-indol-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1c[nH]c2ccc(OCCC3C[C@@H]4CN(CC(F)(F)F)C[C@@H]4C3)cc12)c1cscn1 |
| InChI | InChI=1S/C23H25F3N4O2S/c24-23(25,26)12-30-9-15-5-14(6-16(15)10-30)3-4-32-17-1-2-19-18(7-17)20(8-27-19)29-22(31)21-11-33-13-28-21/h1-2,7-8,11,13-16,27H,3-6,9-10,12H2,(H,29,31)/t14?,15-,16+ |
| InChIKey | RAMOPEZWRYYHDK-MQVJKMGUSA-N |
| XLogP | 5.17 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |