C20H26N4O3S2 — CID 16898725
2-[2-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-pentylacetamide (PubChem CID 16898725) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 2-[2-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-pentylacetamide.
| Compound Name | 2-[2-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-pentylacetamide |
|---|---|
| PubChem CID | 16898725 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[2-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)Cc1csc(SCC(=O)Nc2ccc(NC(C)=O)cc2)n1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-3-4-5-10-21-18(26)11-17-12-28-20(24-17)29-13-19(27)23-16-8-6-15(7-9-16)22-14(2)25/h6-9,12H,3-5,10-11,13H2,1-2H3,(H,21,26)(H,22,25)(H,23,27) |
| InChIKey | LIYZRKNHWMMVIZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|