About 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium
2-propan-2-ylidene-1,3-dihydroisoindol-2-ium (PubChem CID 168987701) has the molecular formula C11H14N+
and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium.
Molecular Properties
| Compound Name | 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium |
| PubChem CID | 168987701 |
| Molecular Formula | C11H14N+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium |
| SMILES | CC(C)=[N+]1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H14N/c1-9(2)12-7-10-5-3-4-6-11(10)8-12/h3-6H,7-8H2,1-2H3/q+1 |
| InChIKey | XNISMIYSXDTISD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium?
The IUPAC name of 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium (CID 168987701) is 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium.
What is the SMILES notation for 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium?
The canonical SMILES for 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium is CC(C)=[N+]1Cc2ccccc2C1.
What is the InChIKey of 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium?
The InChIKey is XNISMIYSXDTISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N/c1-9(2)12-7-10-5-3-4-6-11(10)8-12/h3-6H,7-8H2,1-2H3/q+1.
What are the key properties of 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium?
2-propan-2-ylidene-1,3-dihydroisoindol-2-ium has a molecular weight of 160.24 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylidene-1,3-dihydroisoindol-2-ium is sourced from PubChem (CID 168987701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).