About 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole
1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole (PubChem CID 168987799) has the molecular formula C14H21BrFNS
and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole |
| PubChem CID | 168987799 |
| Molecular Formula | C14H21BrFNS |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole |
| SMILES | CC(C)C.Fc1ccccc1Br.SN1CC=CC1 |
| InChI | InChI=1S/C6H4BrF.C4H7NS.C4H10/c7-5-3-1-2-4-6(5)8;6-5-3-1-2-4-5;1-4(2)3/h1-4H;1-2,6H,3-4H2;4H,1-3H3 |
| InChIKey | MSBLAKQGQWFZQP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole?
The IUPAC name of 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole (CID 168987799) is 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole.
What is the SMILES notation for 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole?
The canonical SMILES for 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole is CC(C)C.Fc1ccccc1Br.SN1CC=CC1.
What is the InChIKey of 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole?
The InChIKey is MSBLAKQGQWFZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF.C4H7NS.C4H10/c7-5-3-1-2-4-6(5)8;6-5-3-1-2-4-5;1-4(2)3/h1-4H;1-2,6H,3-4H2;4H,1-3H3.
What are the key properties of 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole?
1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole has a molecular weight of 334.30 g/mol, XLogP of 4.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole is sourced from PubChem (CID 168987799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).