C14H21BrFNS — CID 168987799
1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole (PubChem CID 168987799) has the molecular formula C14H21BrFNS and a molecular weight of 334.30 g/mol. Its IUPAC name is 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole.
| Compound Name | 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 168987799 |
| Molecular Formula | C14H21BrFNS |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-bromo-2-fluorobenzene;2-methylpropane;1-sulfanyl-2,5-dihydropyrrole |
| SMILES | CC(C)C.Fc1ccccc1Br.SN1CC=CC1 |
| InChI | InChI=1S/C6H4BrF.C4H7NS.C4H10/c7-5-3-1-2-4-6(5)8;6-5-3-1-2-4-5;1-4(2)3/h1-4H;1-2,6H,3-4H2;4H,1-3H3 |
| InChIKey | MSBLAKQGQWFZQP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|