C22H31ClF2N6O2 — CID 168987913
(4,4-difluoropiperidin-1-yl)-[6-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)-3-pyridinyl]methanone;N,N-dimethylcarbamoyl chloride;ethane (PubChem CID 168987913) has the molecular formula C22H31ClF2N6O2 and a molecular weight of 484.98 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[6-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)-3-pyridinyl]methanone;N,N-dimethylcarbamoyl chloride;ethane.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[6-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)-3-pyridinyl]methanone;N,N-dimethylcarbamoyl chloride;ethane |
|---|---|
| PubChem CID | 168987913 |
| Molecular Formula | C22H31ClF2N6O2 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[6-(4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-1-yl)-3-pyridinyl]methanone;N,N-dimethylcarbamoyl chloride;ethane |
| SMILES | CC.CN(C)C(=O)Cl.O=C(c1ccc(-n2ncc3c2CCNC3)nc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H19F2N5O.C3H6ClNO.C2H6/c18-17(19)4-7-23(8-5-17)16(25)12-1-2-15(21-10-12)24-14-3-6-20-9-13(14)11-22-24;1-5(2)3(4)6;1-2/h1-2,10-11,20H,3-9H2;1-2H3;1-2H3 |
| InChIKey | NMSAWNYQZZMHHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|