About 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine
1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine (PubChem CID 168988182) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine |
| PubChem CID | 168988182 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine |
| SMILES | C=C(F)/C=C\C(=C)N1CCC(NC)C1 |
| InChI | InChI=1S/C11H17FN2/c1-9(12)4-5-10(2)14-7-6-11(8-14)13-3/h4-5,11,13H,1-2,6-8H2,3H3/b5-4- |
| InChIKey | JIHALSSLMKORHA-PLNGDYQASA-N |
| XLogP | 1.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine?
The IUPAC name of 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine (CID 168988182) is 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine.
What is the SMILES notation for 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine?
The canonical SMILES for 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine is C=C(F)/C=C\C(=C)N1CCC(NC)C1.
What is the InChIKey of 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine?
The InChIKey is JIHALSSLMKORHA-PLNGDYQASA-N. The full InChI is InChI=1S/C11H17FN2/c1-9(12)4-5-10(2)14-7-6-11(8-14)13-3/h4-5,11,13H,1-2,6-8H2,3H3/b5-4-.
What are the key properties of 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine?
1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine has a molecular weight of 196.27 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylpyrrolidin-3-amine is sourced from PubChem (CID 168988182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).