C17H16N4O — CID 168988813
N-[4-(4-cyano-3-pyridinyl)-2-pyrrolidin-1-ylphenyl]formamide (PubChem CID 168988813) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[4-(4-cyano-3-pyridinyl)-2-pyrrolidin-1-ylphenyl]formamide.
| Compound Name | N-[4-(4-cyano-3-pyridinyl)-2-pyrrolidin-1-ylphenyl]formamide |
|---|---|
| PubChem CID | 168988813 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-[4-(4-cyano-3-pyridinyl)-2-pyrrolidin-1-ylphenyl]formamide |
| SMILES | N#Cc1ccncc1-c1ccc(NC=O)c(N2CCCC2)c1 |
| InChI | InChI=1S/C17H16N4O/c18-10-14-5-6-19-11-15(14)13-3-4-16(20-12-22)17(9-13)21-7-1-2-8-21/h3-6,9,11-12H,1-2,7-8H2,(H,20,22) |
| InChIKey | PBKGGAXEHRSMDX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|