C12H19NO3 — CID 168990862
ethyl 2,3,3a,5,6,7,8,8a-octahydrofuro[2,3-b]pyrrolizine-7a-carboxylate (PubChem CID 168990862) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl 2,3,3a,5,6,7,8,8a-octahydrofuro[2,3-b]pyrrolizine-7a-carboxylate.
| Compound Name | ethyl 2,3,3a,5,6,7,8,8a-octahydrofuro[2,3-b]pyrrolizine-7a-carboxylate |
|---|---|
| PubChem CID | 168990862 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethyl 2,3,3a,5,6,7,8,8a-octahydrofuro[2,3-b]pyrrolizine-7a-carboxylate |
| SMILES | CCOC(=O)C12CCCN1C1CCOC1C2 |
| InChI | InChI=1S/C12H19NO3/c1-2-15-11(14)12-5-3-6-13(12)9-4-7-16-10(9)8-12/h9-10H,2-8H2,1H3 |
| InChIKey | BRFNDDOJJIZAOU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |