C19H14Cl2N6O — CID 168991613
1-[2,5-dichloro-6-[5-[(6-methylpyridazin-3-yl)amino]benzimidazol-1-yl]-3-pyridinyl]ethanone (PubChem CID 168991613) has the molecular formula C19H14Cl2N6O and a molecular weight of 413.27 g/mol. Its IUPAC name is 1-[2,5-dichloro-6-[5-[(6-methylpyridazin-3-yl)amino]benzimidazol-1-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[2,5-dichloro-6-[5-[(6-methylpyridazin-3-yl)amino]benzimidazol-1-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 168991613 |
| Molecular Formula | C19H14Cl2N6O |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 1-[2,5-dichloro-6-[5-[(6-methylpyridazin-3-yl)amino]benzimidazol-1-yl]-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)c(-n2cnc3cc(Nc4ccc(C)nn4)ccc32)nc1Cl |
| InChI | InChI=1S/C19H14Cl2N6O/c1-10-3-6-17(26-25-10)23-12-4-5-16-15(7-12)22-9-27(16)19-14(20)8-13(11(2)28)18(21)24-19/h3-9H,1-2H3,(H,23,26) |
| InChIKey | SEBBBHJPIJZNNN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|