About CID 168992047
CID 168992047 (PubChem CID 168992047) has the molecular formula C13H22BF2N2O2
and a molecular weight of 287.14 g/mol.
Molecular Properties
| Compound Name | CID 168992047 |
| PubChem CID | 168992047 |
| Molecular Formula | C13H22BF2N2O2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | — |
| SMILES | Cc1c([B]OC(C)(C)C(C)(C)O)cnn1CC(C)(F)F |
| InChI | InChI=1S/C13H22BF2N2O2/c1-9-10(7-17-18(9)8-13(6,15)16)14-20-12(4,5)11(2,3)19/h7,19H,8H2,1-6H3 |
| InChIKey | AHACOAUSNCFYPG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 168992047 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168992047?
The IUPAC name of CID 168992047 (CID 168992047) is not available.
What is the SMILES notation for CID 168992047?
The canonical SMILES for CID 168992047 is Cc1c([B]OC(C)(C)C(C)(C)O)cnn1CC(C)(F)F.
What is the InChIKey of CID 168992047?
The InChIKey is AHACOAUSNCFYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22BF2N2O2/c1-9-10(7-17-18(9)8-13(6,15)16)14-20-12(4,5)11(2,3)19/h7,19H,8H2,1-6H3.
What are the key properties of CID 168992047?
CID 168992047 has a molecular weight of 287.14 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168992047 is sourced from PubChem (CID 168992047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).