About (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea
(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea (PubChem CID 168992131) has the molecular formula C7H11N5S
and a molecular weight of 197.27 g/mol. Its IUPAC name is (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea.
Molecular Properties
| Compound Name | (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea |
| PubChem CID | 168992131 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea |
| SMILES | NC(=S)Nc1n[nH]c(C2CCC2)n1 |
| InChI | InChI=1S/C7H11N5S/c8-6(13)10-7-9-5(11-12-7)4-2-1-3-4/h4H,1-3H2,(H4,8,9,10,11,12,13) |
| InChIKey | DHTRWHWQEKEHID-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea?
The IUPAC name of (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea (CID 168992131) is (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea.
What is the SMILES notation for (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea?
The canonical SMILES for (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea is NC(=S)Nc1n[nH]c(C2CCC2)n1.
What is the InChIKey of (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea?
The InChIKey is DHTRWHWQEKEHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5S/c8-6(13)10-7-9-5(11-12-7)4-2-1-3-4/h4H,1-3H2,(H4,8,9,10,11,12,13).
What are the key properties of (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea?
(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea has a molecular weight of 197.27 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiourea is sourced from PubChem (CID 168992131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).