C40H41F3N6O5 — CID 168992448
4-[4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]butoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992448) has the molecular formula C40H41F3N6O5 and a molecular weight of 742.80 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]butoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]butoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992448 |
| Molecular Formula | C40H41F3N6O5 |
| Molecular Weight | 742.80 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | 4-[4-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]butoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3ccc(OCCCCN4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)cc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C40H41F3N6O5/c41-40(42,43)34-24-30(6-3-28(34)25-44)47-16-13-27(14-17-47)26-4-8-31(9-5-26)54-22-2-1-15-46-18-20-48(21-19-46)29-7-10-32-33(23-29)39(53)49(38(32)52)35-11-12-36(50)45-37(35)51/h3-10,23-24,27,35H,1-2,11-22H2,(H,45,50,51) |
| InChIKey | DQEMJFSABASELK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|