C39H41F3N6O4 — CID 168992552
4-[4-[4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 168992552) has the molecular formula C39H41F3N6O4 and a molecular weight of 714.79 g/mol. Its IUPAC name is 4-[4-[4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168992552 |
| Molecular Formula | C39H41F3N6O4 |
| Molecular Weight | 714.79 g/mol |
| Exact Mass | 714.31 |
| IUPAC Name | 4-[4-[4-[3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperazin-1-yl]propoxy]phenyl]piperidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCC(c3ccc(OCCCN4CCN(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)CC4)cc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C39H41F3N6O4/c40-39(41,42)34-23-31(5-2-28(34)24-43)46-15-12-27(13-16-46)26-3-7-32(8-4-26)52-21-1-14-45-17-19-47(20-18-45)30-6-9-33-29(22-30)25-48(38(33)51)35-10-11-36(49)44-37(35)50/h2-9,22-23,27,35H,1,10-21,25H2,(H,44,49,50) |
| InChIKey | HJLNFVSSNIFDNV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|