About 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane
2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane (PubChem CID 168992663) has the molecular formula C22H33NOS
and a molecular weight of 359.58 g/mol. Its IUPAC name is 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane.
Molecular Properties
| Compound Name | 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane |
| PubChem CID | 168992663 |
| Molecular Formula | C22H33NOS |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane |
| SMILES | CC(C)(C)S(C)(c1ccccc1)c1ccccc1.OCCC1CNC1 |
| InChI | InChI=1S/C17H22S.C5H11NO/c1-17(2,3)18(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16;7-2-1-5-3-6-4-5/h5-14H,1-4H3;5-7H,1-4H2 |
| InChIKey | DICUMTKOVZFECO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane?
The IUPAC name of 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane (CID 168992663) is 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane.
What is the SMILES notation for 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane?
The canonical SMILES for 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane is CC(C)(C)S(C)(c1ccccc1)c1ccccc1.OCCC1CNC1.
What is the InChIKey of 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane?
The InChIKey is DICUMTKOVZFECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22S.C5H11NO/c1-17(2,3)18(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16;7-2-1-5-3-6-4-5/h5-14H,1-4H3;5-7H,1-4H2.
What are the key properties of 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane?
2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane has a molecular weight of 359.58 g/mol, XLogP of 4.93, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yl)ethanol;tert-butyl-methyl-diphenyl-λ4-sulfane is sourced from PubChem (CID 168992663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).