C44H54F3N5O2 — CID 168992801
N-formyl-4-[3-methylidene-6-[4-[4-[4-[1-[4-prop-1-en-2-yl-3-(trifluoromethyl)phenyl]piperidin-4-yl]phenyl]butyl]piperazin-1-yl]-1H-isoindol-2-yl]pentanamide (PubChem CID 168992801) has the molecular formula C44H54F3N5O2 and a molecular weight of 741.94 g/mol. Its IUPAC name is N-formyl-4-[3-methylidene-6-[4-[4-[4-[1-[4-prop-1-en-2-yl-3-(trifluoromethyl)phenyl]piperidin-4-yl]phenyl]butyl]piperazin-1-yl]-1H-isoindol-2-yl]pentanamide.
| Compound Name | N-formyl-4-[3-methylidene-6-[4-[4-[4-[1-[4-prop-1-en-2-yl-3-(trifluoromethyl)phenyl]piperidin-4-yl]phenyl]butyl]piperazin-1-yl]-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 168992801 |
| Molecular Formula | C44H54F3N5O2 |
| Molecular Weight | 741.94 g/mol |
| Exact Mass | 741.42 |
| IUPAC Name | N-formyl-4-[3-methylidene-6-[4-[4-[4-[1-[4-prop-1-en-2-yl-3-(trifluoromethyl)phenyl]piperidin-4-yl]phenyl]butyl]piperazin-1-yl]-1H-isoindol-2-yl]pentanamide |
| SMILES | C=C(C)c1ccc(N2CCC(c3ccc(CCCCN4CCN(c5ccc6c(c5)CN(C(C)CCC(=O)NC=O)C6=C)CC4)cc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C44H54F3N5O2/c1-31(2)40-15-13-39(28-42(40)44(45,46)47)50-21-18-36(19-22-50)35-11-9-34(10-12-35)7-5-6-20-49-23-25-51(26-24-49)38-14-16-41-33(4)52(29-37(41)27-38)32(3)8-17-43(54)48-30-53/h9-16,27-28,30,32,36H,1,4-8,17-26,29H2,2-3H3,(H,48,53,54) |
| InChIKey | LSQYBSYZITVWBD-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.94 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|