C66H52B10BrN3O — CID 168993959
CID 168993959 (PubChem CID 168993959) has the molecular formula C66H52B10BrN3O and a molecular weight of 1091.19 g/mol.
| Compound Name | CID 168993959 |
|---|---|
| PubChem CID | 168993959 |
| Molecular Formula | C66H52B10BrN3O |
| Molecular Weight | 1091.19 g/mol |
| Exact Mass | 1091.42 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2cccc(N(c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3)c3cc(C(C)(C)C)cc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)c3Br)c2)c2c([B])c([B])c([B])c([B])c2[B])c([B])c1[B] |
| InChI | InChI=1S/C66H52B10BrN3O/c1-64(2,3)37-20-26-41(27-21-37)78(42-28-22-38(23-29-42)65(4,5)6)47-32-39(66(7,8)9)33-48(61(47)77)79(40-24-17-35(18-25-40)36-19-30-46-45-15-10-11-16-49(45)81-50(46)31-36)43-13-12-14-44(34-43)80(62-57(73)53(69)51(67)54(70)58(62)74)63-59(75)55(71)52(68)56(72)60(63)76/h10-34H,1-9H3 |
| InChIKey | UDCYRUFACUXUNQ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 22.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.19 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|