About 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile
4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile (PubChem CID 168994477) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile.
Molecular Properties
| Compound Name | 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile |
| PubChem CID | 168994477 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile |
| SMILES | N#CCCCc1n[nH]c(=O)c2cccnc12 |
| InChI | InChI=1S/C11H10N4O/c12-6-2-1-5-9-10-8(4-3-7-13-10)11(16)15-14-9/h3-4,7H,1-2,5H2,(H,15,16) |
| InChIKey | GQMONOYXYNUIIE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile?
The IUPAC name of 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile (CID 168994477) is 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile.
What is the SMILES notation for 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile?
The canonical SMILES for 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile is N#CCCCc1n[nH]c(=O)c2cccnc12.
What is the InChIKey of 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile?
The InChIKey is GQMONOYXYNUIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c12-6-2-1-5-9-10-8(4-3-7-13-10)11(16)15-14-9/h3-4,7H,1-2,5H2,(H,15,16).
What are the key properties of 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile?
4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile has a molecular weight of 214.23 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)butanenitrile is sourced from PubChem (CID 168994477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).