C31H59N4O7P — CID 168994670
4-[(3R)-3-[(3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazin-8-yl]pyrrolidin-1-yl]butyl bis(2-methylpropyl) phosphate (PubChem CID 168994670) has the molecular formula C31H59N4O7P and a molecular weight of 630.81 g/mol. Its IUPAC name is 4-[(3R)-3-[(3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazin-8-yl]pyrrolidin-1-yl]butyl bis(2-methylpropyl) phosphate.
| Compound Name | 4-[(3R)-3-[(3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazin-8-yl]pyrrolidin-1-yl]butyl bis(2-methylpropyl) phosphate |
|---|---|
| PubChem CID | 168994670 |
| Molecular Formula | C31H59N4O7P |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 4-[(3R)-3-[(3R,6S,9aS)-6-(2,2-dimethylpropyl)-3-(2-methylpropyl)-4,7-dioxo-1,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]oxadiazin-8-yl]pyrrolidin-1-yl]butyl bis(2-methylpropyl) phosphate |
| SMILES | CC(C)COP(=O)(OCCCCN1CC[C@@H](N2C[C@@H]3NO[C@H](CC(C)C)C(=O)N3[C@@H](CC(C)(C)C)C2=O)C1)OCC(C)C |
| InChI | InChI=1S/C31H59N4O7P/c1-22(2)16-27-30(37)35-26(17-31(7,8)9)29(36)34(19-28(35)32-42-27)25-12-14-33(18-25)13-10-11-15-39-43(38,40-20-23(3)4)41-21-24(5)6/h22-28,32H,10-21H2,1-9H3/t25-,26+,27-,28-/m1/s1 |
| InChIKey | PFSPQKWTJIGQKS-JUDWXZBOSA-N |
| XLogP | 5.06 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|