About ethane;2-oxa-4,8-diazaspiro[5.5]undecane
ethane;2-oxa-4,8-diazaspiro[5.5]undecane (PubChem CID 168995397) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;2-oxa-4,8-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | ethane;2-oxa-4,8-diazaspiro[5.5]undecane |
| PubChem CID | 168995397 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | ethane;2-oxa-4,8-diazaspiro[5.5]undecane |
| SMILES | C1CNCC2(C1)CNCOC2.CC |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-2-8(4-9-3-1)5-10-7-11-6-8;1-2/h9-10H,1-7H2;1-2H3 |
| InChIKey | YWYLOOBWVXHTRM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-oxa-4,8-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-oxa-4,8-diazaspiro[5.5]undecane?
The IUPAC name of ethane;2-oxa-4,8-diazaspiro[5.5]undecane (CID 168995397) is ethane;2-oxa-4,8-diazaspiro[5.5]undecane.
What is the SMILES notation for ethane;2-oxa-4,8-diazaspiro[5.5]undecane?
The canonical SMILES for ethane;2-oxa-4,8-diazaspiro[5.5]undecane is C1CNCC2(C1)CNCOC2.CC.
What is the InChIKey of ethane;2-oxa-4,8-diazaspiro[5.5]undecane?
The InChIKey is YWYLOOBWVXHTRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H6/c1-2-8(4-9-3-1)5-10-7-11-6-8;1-2/h9-10H,1-7H2;1-2H3.
What are the key properties of ethane;2-oxa-4,8-diazaspiro[5.5]undecane?
ethane;2-oxa-4,8-diazaspiro[5.5]undecane has a molecular weight of 186.30 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-oxa-4,8-diazaspiro[5.5]undecane is sourced from PubChem (CID 168995397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).