C13H30N2O — CID 168995705
ethane;3-ethyl-6-methyl-N-propyl-1,3-oxazepan-5-amine (PubChem CID 168995705) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is ethane;3-ethyl-6-methyl-N-propyl-1,3-oxazepan-5-amine.
| Compound Name | ethane;3-ethyl-6-methyl-N-propyl-1,3-oxazepan-5-amine |
|---|---|
| PubChem CID | 168995705 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | ethane;3-ethyl-6-methyl-N-propyl-1,3-oxazepan-5-amine |
| SMILES | CC.CCCNC1CN(CC)COCC1C |
| InChI | InChI=1S/C11H24N2O.C2H6/c1-4-6-12-11-7-13(5-2)9-14-8-10(11)3;1-2/h10-12H,4-9H2,1-3H3;1-2H3 |
| InChIKey | FESKCVCMTIWXLV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |