C12H17NO2 — CID 168995900
4-cyclohexa-1,5-dien-1-yl-N-(2-oxoethyl)butanamide (PubChem CID 168995900) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-(2-oxoethyl)butanamide.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-(2-oxoethyl)butanamide |
|---|---|
| PubChem CID | 168995900 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-(2-oxoethyl)butanamide |
| SMILES | O=CCNC(=O)CCCC1=CCCC=C1 |
| InChI | InChI=1S/C12H17NO2/c14-10-9-13-12(15)8-4-7-11-5-2-1-3-6-11/h2,5-6,10H,1,3-4,7-9H2,(H,13,15) |
| InChIKey | GUNGSRCZHBFZSY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|