C38H41F2IN6NiO3S- — CID 168996014
CID 168996014 (PubChem CID 168996014) has the molecular formula C38H41F2IN6NiO3S- and a molecular weight of 885.44 g/mol.
| Compound Name | CID 168996014 |
|---|---|
| PubChem CID | 168996014 |
| Molecular Formula | C38H41F2IN6NiO3S- |
| Molecular Weight | 885.44 g/mol |
| Exact Mass | 884.13 |
| IUPAC Name | — |
| SMILES | COC1CN(C(=O)C23CC4CC2C(CN(c2nc(O[C@@H](C)[C@@H]5CCCN5C)nc5c(F)c(-c6ccc(F)c7sc(N)c(C#[Ni])c67)c([IH-])cc25)C4)C3)C1 |
| InChI | InChI=1S/C38H40F2IN6O3S.Ni/c1-18-29-23(7-8-26(39)33(29)51-34(18)42)30-27(41)11-24-32(31(30)40)43-37(50-19(2)28-6-5-9-45(28)3)44-35(24)46-14-20-10-25-21(15-46)13-38(25,12-20)36(48)47-16-22(17-47)49-4;/h7-8,11,19-22,25,28H,5-6,9-10,12-17,42H2,2-4H3;/q-1;/t19-,20?,21?,25?,28-,38?;/m0./s1 |
| InChIKey | LFDIUFDRMQRMNH-PDADAUOSSA-N |
| XLogP | 2.25 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|