About (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane
(2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane (PubChem CID 168996092) has the molecular formula C9H20FNO
and a molecular weight of 177.26 g/mol. Its IUPAC name is (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane.
Molecular Properties
| Compound Name | (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane |
| PubChem CID | 168996092 |
| Molecular Formula | C9H20FNO |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane |
| SMILES | CCOC.C[C@@H]1C(F)CCN1C |
| InChI | InChI=1S/C6H12FN.C3H8O/c1-5-6(7)3-4-8(5)2;1-3-4-2/h5-6H,3-4H2,1-2H3;3H2,1-2H3/t5-,6?;/m1./s1 |
| InChIKey | JSXRYAIIJKBJHA-VQALBSKCSA-N |
| XLogP | 1.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane?
The IUPAC name of (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane (CID 168996092) is (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane.
What is the SMILES notation for (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane?
The canonical SMILES for (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane is CCOC.C[C@@H]1C(F)CCN1C.
What is the InChIKey of (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane?
The InChIKey is JSXRYAIIJKBJHA-VQALBSKCSA-N. The full InChI is InChI=1S/C6H12FN.C3H8O/c1-5-6(7)3-4-8(5)2;1-3-4-2/h5-6H,3-4H2,1-2H3;3H2,1-2H3/t5-,6?;/m1./s1.
What are the key properties of (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane?
(2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane has a molecular weight of 177.26 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-fluoro-1,2-dimethylpyrrolidine;methoxyethane is sourced from PubChem (CID 168996092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).