About 6-methyl-3,4-dihydro-2H-chromene-5,8-diol
6-methyl-3,4-dihydro-2H-chromene-5,8-diol (PubChem CID 168996294) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-chromene-5,8-diol.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-2H-chromene-5,8-diol |
| PubChem CID | 168996294 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-chromene-5,8-diol |
| SMILES | Cc1cc(O)c2c(c1O)CCCO2 |
| InChI | InChI=1S/C10H12O3/c1-6-5-8(11)10-7(9(6)12)3-2-4-13-10/h5,11-12H,2-4H2,1H3 |
| InChIKey | GKEYSFVLRIZCRN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3,4-dihydro-2H-chromene-5,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-chromene-5,8-diol?
The IUPAC name of 6-methyl-3,4-dihydro-2H-chromene-5,8-diol (CID 168996294) is 6-methyl-3,4-dihydro-2H-chromene-5,8-diol.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-chromene-5,8-diol?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-chromene-5,8-diol is Cc1cc(O)c2c(c1O)CCCO2.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-chromene-5,8-diol?
The InChIKey is GKEYSFVLRIZCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-6-5-8(11)10-7(9(6)12)3-2-4-13-10/h5,11-12H,2-4H2,1H3.
What are the key properties of 6-methyl-3,4-dihydro-2H-chromene-5,8-diol?
6-methyl-3,4-dihydro-2H-chromene-5,8-diol has a molecular weight of 180.20 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-chromene-5,8-diol is sourced from PubChem (CID 168996294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).