About 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one
6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one (PubChem CID 168996307) has the molecular formula C15H19BrN2O3
and a molecular weight of 355.23 g/mol. Its IUPAC name is 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one |
| PubChem CID | 168996307 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one |
| SMILES | CC1(O)CC(N2C(=O)CCc3cc(OCCBr)cnc32)C1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-15(20)7-11(8-15)18-13(19)3-2-10-6-12(21-5-4-16)9-17-14(10)18/h6,9,11,20H,2-5,7-8H2,1H3 |
| InChIKey | GIGYSFKMAYISLP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one?
The IUPAC name of 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one (CID 168996307) is 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one.
What is the SMILES notation for 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one?
The canonical SMILES for 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one is CC1(O)CC(N2C(=O)CCc3cc(OCCBr)cnc32)C1.
What is the InChIKey of 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one?
The InChIKey is GIGYSFKMAYISLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN2O3/c1-15(20)7-11(8-15)18-13(19)3-2-10-6-12(21-5-4-16)9-17-14(10)18/h6,9,11,20H,2-5,7-8H2,1H3.
What are the key properties of 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one?
6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one has a molecular weight of 355.23 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-bromoethoxy)-1-(3-hydroxy-3-methylcyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one is sourced from PubChem (CID 168996307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).