About methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate
methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate (PubChem CID 168996517) has the molecular formula C22H22ClFN2O4
and a molecular weight of 432.88 g/mol. Its IUPAC name is methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate |
| PubChem CID | 168996517 |
| Molecular Formula | C22H22ClFN2O4 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(OCCN2CCC3(CC2)C(=O)Nc2ccc(Cl)cc23)cc1F |
| InChI | InChI=1S/C22H22ClFN2O4/c1-29-20(27)16-4-3-15(13-18(16)24)30-11-10-26-8-6-22(7-9-26)17-12-14(23)2-5-19(17)25-21(22)28/h2-5,12-13H,6-11H2,1H3,(H,25,28) |
| InChIKey | QWTCEVFOWLJVIB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate?
The IUPAC name of methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate (CID 168996517) is methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate.
What is the SMILES notation for methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate?
The canonical SMILES for methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate is COC(=O)c1ccc(OCCN2CCC3(CC2)C(=O)Nc2ccc(Cl)cc23)cc1F.
What is the InChIKey of methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate?
The InChIKey is QWTCEVFOWLJVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClFN2O4/c1-29-20(27)16-4-3-15(13-18(16)24)30-11-10-26-8-6-22(7-9-26)17-12-14(23)2-5-19(17)25-21(22)28/h2-5,12-13H,6-11H2,1H3,(H,25,28).
What are the key properties of methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate?
methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate has a molecular weight of 432.88 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(5-chloro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)ethoxy]-2-fluorobenzoate is sourced from PubChem (CID 168996517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).